C10H5F4NO — CID 117333519
1,2,4,5-tetrafluoro-3-(1-isocyanatocyclopropyl)benzene (PubChem CID 117333519) has the molecular formula C10H5F4NO and a molecular weight of 231.15 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-(1-isocyanatocyclopropyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-(1-isocyanatocyclopropyl)benzene |
|---|---|
| PubChem CID | 117333519 |
| Molecular Formula | C10H5F4NO |
| Molecular Weight | 231.15 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-(1-isocyanatocyclopropyl)benzene |
| SMILES | O=C=NC1(c2c(F)c(F)cc(F)c2F)CC1 |
| InChI | InChI=1S/C10H5F4NO/c11-5-3-6(12)9(14)7(8(5)13)10(1-2-10)15-4-16/h3H,1-2H2 |
| InChIKey | NCPYVKZGRREBEB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.15 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|