C8H8INO3 — CID 87861226
2,4-dihydroxy-5-iodo-3-methylbenzamide (PubChem CID 87861226) has the molecular formula C8H8INO3 and a molecular weight of 293.06 g/mol. Its IUPAC name is 2,4-dihydroxy-5-iodo-3-methylbenzamide.
| Compound Name | 2,4-dihydroxy-5-iodo-3-methylbenzamide |
|---|---|
| PubChem CID | 87861226 |
| Molecular Formula | C8H8INO3 |
| Molecular Weight | 293.06 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | 2,4-dihydroxy-5-iodo-3-methylbenzamide |
| SMILES | Cc1c(O)c(I)cc(C(N)=O)c1O |
| InChI | InChI=1S/C8H8INO3/c1-3-6(11)4(8(10)13)2-5(9)7(3)12/h2,11-12H,1H3,(H2,10,13) |
| InChIKey | LYCNCRDZWNHNTK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.06 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|