C8H4I3NO3 — CID 88756924
3-carbamoyl-2,5,6-triiodobenzoic acid (PubChem CID 88756924) has the molecular formula C8H4I3NO3 and a molecular weight of 542.84 g/mol. Its IUPAC name is 3-carbamoyl-2,5,6-triiodobenzoic acid.
| Compound Name | 3-carbamoyl-2,5,6-triiodobenzoic acid |
|---|---|
| PubChem CID | 88756924 |
| Molecular Formula | C8H4I3NO3 |
| Molecular Weight | 542.84 g/mol |
| Exact Mass | 542.73 |
| IUPAC Name | 3-carbamoyl-2,5,6-triiodobenzoic acid |
| SMILES | NC(=O)c1cc(I)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C8H4I3NO3/c9-3-1-2(7(12)13)5(10)4(6(3)11)8(14)15/h1H,(H2,12,13)(H,14,15) |
| InChIKey | IHSZCCUYQVZZHJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|