C7H5I2NO2 — CID 131091000
5-amino-2,3-diiodobenzoic acid (PubChem CID 131091000) has the molecular formula C7H5I2NO2 and a molecular weight of 388.93 g/mol. Its IUPAC name is 5-amino-2,3-diiodobenzoic acid.
| Compound Name | 5-amino-2,3-diiodobenzoic acid |
|---|---|
| PubChem CID | 131091000 |
| Molecular Formula | C7H5I2NO2 |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.84 |
| IUPAC Name | 5-amino-2,3-diiodobenzoic acid |
| SMILES | Nc1cc(I)c(I)c(C(=O)O)c1 |
| InChI | InChI=1S/C7H5I2NO2/c8-5-2-3(10)1-4(6(5)9)7(11)12/h1-2H,10H2,(H,11,12) |
| InChIKey | UYVUSFFNVKMTPE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|