C7H3I3O3 — CID 88695592
3-hydroxy-2,4,5-triiodobenzoic acid (PubChem CID 88695592) has the molecular formula C7H3I3O3 and a molecular weight of 515.81 g/mol. Its IUPAC name is 3-hydroxy-2,4,5-triiodobenzoic acid.
| Compound Name | 3-hydroxy-2,4,5-triiodobenzoic acid |
|---|---|
| PubChem CID | 88695592 |
| Molecular Formula | C7H3I3O3 |
| Molecular Weight | 515.81 g/mol |
| Exact Mass | 515.72 |
| IUPAC Name | 3-hydroxy-2,4,5-triiodobenzoic acid |
| SMILES | O=C(O)c1cc(I)c(I)c(O)c1I |
| InChI | InChI=1S/C7H3I3O3/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,11H,(H,12,13) |
| InChIKey | YTCBSNDJMUFYSG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.81 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|