3-hydroxy-2,4,5-triiodobenzoic acid

C7H3I3O3 — CID 88695592

IUPAC3-hydroxy-2,4,5-triiodobenzoic acid
SMILESO=C(O)c1cc(I)c(I)c(O)c1I
InChIInChI=1S/C7H3I3O3/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,11H,(H,12,13)
InChIKeyYTCBSNDJMUFYSG-UHFFFAOYSA-N
MW515.81 g/mol
LogP2.90
Rot. Bonds1

About 3-hydroxy-2,4,5-triiodobenzoic acid

3-hydroxy-2,4,5-triiodobenzoic acid (PubChem CID 88695592) has the molecular formula C7H3I3O3 and a molecular weight of 515.81 g/mol. Its IUPAC name is 3-hydroxy-2,4,5-triiodobenzoic acid.

Molecular Properties

Compound Name3-hydroxy-2,4,5-triiodobenzoic acid
PubChem CID88695592
Molecular FormulaC7H3I3O3
Molecular Weight515.81 g/mol
Exact Mass515.72
IUPAC Name3-hydroxy-2,4,5-triiodobenzoic acid
SMILESO=C(O)c1cc(I)c(I)c(O)c1I
InChIInChI=1S/C7H3I3O3/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,11H,(H,12,13)
InChIKeyYTCBSNDJMUFYSG-UHFFFAOYSA-N
XLogP2.90
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500515.81
LogP ≤ 52.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 3-hydroxy-2,4,5-triiodobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-2,4,5-triiodobenzoic acid?
The IUPAC name of 3-hydroxy-2,4,5-triiodobenzoic acid (CID 88695592) is 3-hydroxy-2,4,5-triiodobenzoic acid.
What is the SMILES notation for 3-hydroxy-2,4,5-triiodobenzoic acid?
The canonical SMILES for 3-hydroxy-2,4,5-triiodobenzoic acid is O=C(O)c1cc(I)c(I)c(O)c1I.
What is the InChIKey of 3-hydroxy-2,4,5-triiodobenzoic acid?
The InChIKey is YTCBSNDJMUFYSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3I3O3/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1,11H,(H,12,13).
What are the key properties of 3-hydroxy-2,4,5-triiodobenzoic acid?
3-hydroxy-2,4,5-triiodobenzoic acid has a molecular weight of 515.81 g/mol, XLogP of 2.90, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,4,5-triiodobenzoic acid is sourced from PubChem (CID 88695592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).