C8H6I2N2O2 — CID 175130034
2,3-diiodobenzene-1,4-dicarboxamide (PubChem CID 175130034) has the molecular formula C8H6I2N2O2 and a molecular weight of 415.96 g/mol. Its IUPAC name is 2,3-diiodobenzene-1,4-dicarboxamide.
| Compound Name | 2,3-diiodobenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 175130034 |
| Molecular Formula | C8H6I2N2O2 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.85 |
| IUPAC Name | 2,3-diiodobenzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c(I)c1I |
| InChI | InChI=1S/C8H6I2N2O2/c9-5-3(7(11)13)1-2-4(6(5)10)8(12)14/h1-2H,(H2,11,13)(H2,12,14) |
| InChIKey | MCYKMTXGUDUTCZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|