About 2,3-diiodobenzene-1,4-dicarboxamide
2,3-diiodobenzene-1,4-dicarboxamide (PubChem CID 175130034) has the molecular formula C8H6I2N2O2
and a molecular weight of 415.96 g/mol. Its IUPAC name is 2,3-diiodobenzene-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 2,3-diiodobenzene-1,4-dicarboxamide |
| PubChem CID | 175130034 |
| Molecular Formula | C8H6I2N2O2 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.85 |
| IUPAC Name | 2,3-diiodobenzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)c(I)c1I |
| InChI | InChI=1S/C8H6I2N2O2/c9-5-3(7(11)13)1-2-4(6(5)10)8(12)14/h1-2H,(H2,11,13)(H2,12,14) |
| InChIKey | MCYKMTXGUDUTCZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diiodobenzene-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diiodobenzene-1,4-dicarboxamide?
The IUPAC name of 2,3-diiodobenzene-1,4-dicarboxamide (CID 175130034) is 2,3-diiodobenzene-1,4-dicarboxamide.
What is the SMILES notation for 2,3-diiodobenzene-1,4-dicarboxamide?
The canonical SMILES for 2,3-diiodobenzene-1,4-dicarboxamide is NC(=O)c1ccc(C(N)=O)c(I)c1I.
What is the InChIKey of 2,3-diiodobenzene-1,4-dicarboxamide?
The InChIKey is MCYKMTXGUDUTCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6I2N2O2/c9-5-3(7(11)13)1-2-4(6(5)10)8(12)14/h1-2H,(H2,11,13)(H2,12,14).
What are the key properties of 2,3-diiodobenzene-1,4-dicarboxamide?
2,3-diiodobenzene-1,4-dicarboxamide has a molecular weight of 415.96 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diiodobenzene-1,4-dicarboxamide is sourced from PubChem (CID 175130034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).