C19H17F — CID 174532849
8-fluoro-1-methyl-2,3,4,5-tetrahydrochrysene (PubChem CID 174532849) has the molecular formula C19H17F and a molecular weight of 264.34 g/mol. Its IUPAC name is 8-fluoro-1-methyl-2,3,4,5-tetrahydrochrysene.
| Compound Name | 8-fluoro-1-methyl-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174532849 |
| Molecular Formula | C19H17F |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 8-fluoro-1-methyl-2,3,4,5-tetrahydrochrysene |
| SMILES | CC1=c2ccc3c(c2CCC1)CC=c1cc(F)ccc1=3 |
| InChI | InChI=1S/C19H17F/c1-12-3-2-4-17-15(12)9-10-18-16-8-6-14(20)11-13(16)5-7-19(17)18/h5-6,8-11H,2-4,7H2,1H3 |
| InChIKey | QYGJDDZRXKXEDS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |