C26H28 — CID 174797530
cyclohexa-1,3-diene;5,5-dimethyl-3,4-dihydro-2H-chrysene (PubChem CID 174797530) has the molecular formula C26H28 and a molecular weight of 340.51 g/mol. Its IUPAC name is cyclohexa-1,3-diene;5,5-dimethyl-3,4-dihydro-2H-chrysene.
| Compound Name | cyclohexa-1,3-diene;5,5-dimethyl-3,4-dihydro-2H-chrysene |
|---|---|
| PubChem CID | 174797530 |
| Molecular Formula | C26H28 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | cyclohexa-1,3-diene;5,5-dimethyl-3,4-dihydro-2H-chrysene |
| SMILES | C1=CCCC=C1.CC1(C)C=c2ccccc2=c2ccc3c(c21)CCCC=3 |
| InChI | InChI=1S/C20H20.C6H8/c1-20(2)13-15-8-4-5-9-16(15)18-12-11-14-7-3-6-10-17(14)19(18)20;1-2-4-6-5-3-1/h4-5,7-9,11-13H,3,6,10H2,1-2H3;1-4H,5-6H2 |
| InChIKey | RPLPMVSUYMYZSZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |