C23H24O2 — CID 174398352
tert-butyl 8,9,10,11-tetrahydrochrysene-1-carboxylate (PubChem CID 174398352) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl 8,9,10,11-tetrahydrochrysene-1-carboxylate.
| Compound Name | tert-butyl 8,9,10,11-tetrahydrochrysene-1-carboxylate |
|---|---|
| PubChem CID | 174398352 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | tert-butyl 8,9,10,11-tetrahydrochrysene-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cccc2c1=CCc1c3c(ccc1=2)=CCCC3 |
| InChI | InChI=1S/C23H24O2/c1-23(2,3)25-22(24)21-10-6-9-17-19-12-11-15-7-4-5-8-16(15)18(19)13-14-20(17)21/h6-7,9-12,14H,4-5,8,13H2,1-3H3 |
| InChIKey | YHKGKEIQSSUOFR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |