C27H20Cl2O4 — CID 175280787
2-[(7,8-dichloro-2,3,4,5-tetrahydrochrysen-2-yl)methyl]benzene-1,3-dicarboxylic acid (PubChem CID 175280787) has the molecular formula C27H20Cl2O4 and a molecular weight of 479.36 g/mol. Its IUPAC name is 2-[(7,8-dichloro-2,3,4,5-tetrahydrochrysen-2-yl)methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 2-[(7,8-dichloro-2,3,4,5-tetrahydrochrysen-2-yl)methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175280787 |
| Molecular Formula | C27H20Cl2O4 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 2-[(7,8-dichloro-2,3,4,5-tetrahydrochrysen-2-yl)methyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cccc(C(=O)O)c1CC1C=c2ccc3c(c2CC1)CC=c1c(Cl)c(Cl)ccc1=3 |
| InChI | InChI=1S/C27H20Cl2O4/c28-24-11-10-19-18-7-5-15-12-14(4-6-16(15)17(18)8-9-20(19)25(24)29)13-23-21(26(30)31)2-1-3-22(23)27(32)33/h1-3,5,7,9-12,14H,4,6,8,13H2,(H,30,31)(H,32,33) |
| InChIKey | XNGSSTAKICAWOQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |