C34H30BrN3 — CID 163545940
2-[4-(4-bromocyclohexa-1,5-dien-1-yl)-6-methylcyclohexa-2,4-dien-1-yl]-4-cyclohexa-1,3-dien-1-yl-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 163545940) has the molecular formula C34H30BrN3 and a molecular weight of 560.54 g/mol. Its IUPAC name is 2-[4-(4-bromocyclohexa-1,5-dien-1-yl)-6-methylcyclohexa-2,4-dien-1-yl]-4-cyclohexa-1,3-dien-1-yl-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-(4-bromocyclohexa-1,5-dien-1-yl)-6-methylcyclohexa-2,4-dien-1-yl]-4-cyclohexa-1,3-dien-1-yl-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 163545940 |
| Molecular Formula | C34H30BrN3 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 2-[4-(4-bromocyclohexa-1,5-dien-1-yl)-6-methylcyclohexa-2,4-dien-1-yl]-4-cyclohexa-1,3-dien-1-yl-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | CC1C=C(C2=CCC(Br)C=C2)C=CC1c1nc(C2=CC=CCC2)nc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C34H30BrN3/c1-23-22-29(26-16-19-30(35)20-17-26)18-21-31(23)34-37-32(27-10-6-3-7-11-27)36-33(38-34)28-14-12-25(13-15-28)24-8-4-2-5-9-24/h2-6,8-10,12-19,21-23,30-31H,7,11,20H2,1H3 |
| InChIKey | FFAJYHAFIYCHTP-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|