C58H48N2 — CID 166903112
4-(4-cyclohexa-1,3-dien-1-ylphenyl)-2-phenyl-6-[4-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-yl)phenyl]cyclohexa-2,4-dien-1-yl]pyrimidine (PubChem CID 166903112) has the molecular formula C58H48N2 and a molecular weight of 773.04 g/mol. Its IUPAC name is 4-(4-cyclohexa-1,3-dien-1-ylphenyl)-2-phenyl-6-[4-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-yl)phenyl]cyclohexa-2,4-dien-1-yl]pyrimidine.
| Compound Name | 4-(4-cyclohexa-1,3-dien-1-ylphenyl)-2-phenyl-6-[4-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-yl)phenyl]cyclohexa-2,4-dien-1-yl]pyrimidine |
|---|---|
| PubChem CID | 166903112 |
| Molecular Formula | C58H48N2 |
| Molecular Weight | 773.04 g/mol |
| Exact Mass | 772.38 |
| IUPAC Name | 4-(4-cyclohexa-1,3-dien-1-ylphenyl)-2-phenyl-6-[4-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-3-yl)phenyl]cyclohexa-2,4-dien-1-yl]pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)-c1cc(-c2ccc(C4=CCC(c5cc(-c6ccc(C7=CC=CCC7)cc6)nc(-c6ccccc6)n5)C=C4)cc2)ccc1C3(C)C |
| InChI | InChI=1S/C58H48N2/c1-57(2)50-18-12-11-17-46(50)48-34-53-49(35-52(48)57)47-33-45(31-32-51(47)58(53,3)4)41-21-19-39(20-22-41)40-25-29-43(30-26-40)55-36-54(59-56(60-55)44-15-9-6-10-16-44)42-27-23-38(24-28-42)37-13-7-5-8-14-37/h5-7,9-13,15-29,31-36,43H,8,14,30H2,1-4H3 |
| InChIKey | XFSRWXJZDBQPMN-UHFFFAOYSA-N |
| XLogP | 14.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.04 |
| LogP ≤ 5 | 14.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |