C44H37N5 — CID 146481040
6-[3-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,9-dimethyl-7-phenyl-1,2,8,9-tetrahydroindolo[2,3-c]quinoline (PubChem CID 146481040) has the molecular formula C44H37N5 and a molecular weight of 635.82 g/mol. Its IUPAC name is 6-[3-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,9-dimethyl-7-phenyl-1,2,8,9-tetrahydroindolo[2,3-c]quinoline.
| Compound Name | 6-[3-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,9-dimethyl-7-phenyl-1,2,8,9-tetrahydroindolo[2,3-c]quinoline |
|---|---|
| PubChem CID | 146481040 |
| Molecular Formula | C44H37N5 |
| Molecular Weight | 635.82 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | 6-[3-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-1,9-dimethyl-7-phenyl-1,2,8,9-tetrahydroindolo[2,3-c]quinoline |
| SMILES | CC1C=Cc2c(n(-c3ccccc3)c3c(-c4cccc(-c5nc(C6=CC=CCC6)nc(-c6ccccc6)n5)c4)nc4c(c23)C(C)CC=C4)C1 |
| InChI | InChI=1S/C44H37N5/c1-28-24-25-35-37(26-28)49(34-21-10-5-11-22-34)41-39(35)38-29(2)14-12-23-36(38)45-40(41)32-19-13-20-33(27-32)44-47-42(30-15-6-3-7-16-30)46-43(48-44)31-17-8-4-9-18-31/h3-8,10-13,15-17,19-25,27-29H,9,14,18,26H2,1-2H3 |
| InChIKey | OGISAEPPIFMIHS-UHFFFAOYSA-N |
| XLogP | 10.67 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.82 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |