C44H41N3S — CID 155058663
2-(1-benzothiophen-2-yl)-4-cyclohexa-1,3-dien-1-yl-6-[3-(9-cyclohexa-1,3-dien-1-yl-4,7-dimethyl-1,2,3,4,7,8-hexahydrofluoren-9-yl)phenyl]-1,3,5-triazine (PubChem CID 155058663) has the molecular formula C44H41N3S and a molecular weight of 643.90 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-4-cyclohexa-1,3-dien-1-yl-6-[3-(9-cyclohexa-1,3-dien-1-yl-4,7-dimethyl-1,2,3,4,7,8-hexahydrofluoren-9-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(1-benzothiophen-2-yl)-4-cyclohexa-1,3-dien-1-yl-6-[3-(9-cyclohexa-1,3-dien-1-yl-4,7-dimethyl-1,2,3,4,7,8-hexahydrofluoren-9-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 155058663 |
| Molecular Formula | C44H41N3S |
| Molecular Weight | 643.90 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-4-cyclohexa-1,3-dien-1-yl-6-[3-(9-cyclohexa-1,3-dien-1-yl-4,7-dimethyl-1,2,3,4,7,8-hexahydrofluoren-9-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1C=CC2=C(C1)C(C1=CC=CCC1)(c1cccc(-c3nc(C4=CC=CCC4)nc(-c4cc5ccccc5s4)n3)c1)C1=C2C(C)CCC1 |
| InChI | InChI=1S/C44H41N3S/c1-28-23-24-35-37(25-28)44(33-18-7-4-8-19-33,36-21-11-13-29(2)40(35)36)34-20-12-17-32(26-34)42-45-41(30-14-5-3-6-15-30)46-43(47-42)39-27-31-16-9-10-22-38(31)48-39/h3-5,7,9-10,12,14,16-18,20,22-24,26-29H,6,8,11,13,15,19,21,25H2,1-2H3 |
| InChIKey | NNJHXUAPOIAPOH-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.90 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |