C52H38N4O — CID 170065557
9-[4-[4-cyclohexa-1,3-dien-1-yl-6-(6,8-diphenyldibenzofuran-1-yl)-1,3,5-triazin-2-yl]phenyl]-1-methyl-1,2-dihydrocarbazole (PubChem CID 170065557) has the molecular formula C52H38N4O and a molecular weight of 734.90 g/mol. Its IUPAC name is 9-[4-[4-cyclohexa-1,3-dien-1-yl-6-(6,8-diphenyldibenzofuran-1-yl)-1,3,5-triazin-2-yl]phenyl]-1-methyl-1,2-dihydrocarbazole.
| Compound Name | 9-[4-[4-cyclohexa-1,3-dien-1-yl-6-(6,8-diphenyldibenzofuran-1-yl)-1,3,5-triazin-2-yl]phenyl]-1-methyl-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 170065557 |
| Molecular Formula | C52H38N4O |
| Molecular Weight | 734.90 g/mol |
| Exact Mass | 734.30 |
| IUPAC Name | 9-[4-[4-cyclohexa-1,3-dien-1-yl-6-(6,8-diphenyldibenzofuran-1-yl)-1,3,5-triazin-2-yl]phenyl]-1-methyl-1,2-dihydrocarbazole |
| SMILES | CC1CC=Cc2c1n(-c1ccc(-c3nc(C4=CC=CCC4)nc(-c4cccc5oc6c(-c7ccccc7)cc(-c7ccccc7)cc6c45)n3)cc1)c1ccccc21 |
| InChI | InChI=1S/C52H38N4O/c1-33-15-13-23-41-40-22-11-12-25-45(40)56(48(33)41)39-29-27-37(28-30-39)51-53-50(36-20-9-4-10-21-36)54-52(55-51)42-24-14-26-46-47(42)44-32-38(34-16-5-2-6-17-34)31-43(49(44)57-46)35-18-7-3-8-19-35/h2-9,11-14,16-20,22-33H,10,15,21H2,1H3 |
| InChIKey | KMFYCIMLXHSWIF-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.90 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |