C51H32N4O — CID 171050684
3-[4-[6,8-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]-6-phenyl-1,3,5-triazin-2-yl]-9-phenylcarbazole (PubChem CID 171050684) has the molecular formula C51H32N4O and a molecular weight of 726.91 g/mol. Its IUPAC name is 3-[4-[6,8-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]-6-phenyl-1,3,5-triazin-2-yl]-9-phenylcarbazole.
| Compound Name | 3-[4-[6,8-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]-6-phenyl-1,3,5-triazin-2-yl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 171050684 |
| Molecular Formula | C51H32N4O |
| Molecular Weight | 726.91 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | 3-[4-[6,8-bis(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]-6-phenyl-1,3,5-triazin-2-yl]-9-phenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c3oc4cccc(-c5nc(-c6ccccc6)nc(-c6ccc7c(c6)c6ccccc6n7-c6ccccc6)n5)c4c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C51H32N4O/c1-5-16-33(17-6-1)37-31-41(34-18-7-2-8-19-34)48-43(32-37)47-40(25-15-27-46(47)56-48)51-53-49(35-20-9-3-10-21-35)52-50(54-51)36-28-29-45-42(30-36)39-24-13-14-26-44(39)55(45)38-22-11-4-12-23-38/h1-32H/i1D,2D,5D,6D,7D,8D,16D,17D,18D,19D |
| InChIKey | HKYDZYLUMCJFFW-ATMZEYPUSA-N |
| XLogP | 13.20 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.91 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |