C47H29N3O — CID 171050609
2-[6-(2,3,4,5,6-pentadeuteriophenyl)-8-phenyldibenzofuran-1-yl]-4-phenanthren-3-yl-6-phenyl-1,3,5-triazine (PubChem CID 171050609) has the molecular formula C47H29N3O and a molecular weight of 656.80 g/mol. Its IUPAC name is 2-[6-(2,3,4,5,6-pentadeuteriophenyl)-8-phenyldibenzofuran-1-yl]-4-phenanthren-3-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[6-(2,3,4,5,6-pentadeuteriophenyl)-8-phenyldibenzofuran-1-yl]-4-phenanthren-3-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171050609 |
| Molecular Formula | C47H29N3O |
| Molecular Weight | 656.80 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | 2-[6-(2,3,4,5,6-pentadeuteriophenyl)-8-phenyldibenzofuran-1-yl]-4-phenanthren-3-yl-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3ccccc3)cc3c2oc2cccc(-c4nc(-c5ccccc5)nc(-c5ccc6ccc7ccccc7c6c5)n4)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C47H29N3O/c1-4-13-30(14-5-1)36-28-40(31-15-6-2-7-16-31)44-41(29-36)43-38(21-12-22-42(43)51-44)47-49-45(34-18-8-3-9-19-34)48-46(50-47)35-26-25-33-24-23-32-17-10-11-20-37(32)39(33)27-35/h1-29H/i2D,6D,7D,15D,16D |
| InChIKey | PEGSUPOMQJZPFI-RGKSOHIZSA-N |
| XLogP | 12.41 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.80 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|