C45H27N3O2 — CID 171050772
2-dibenzofuran-3-yl-4-[6-(2,3,4,5,6-pentadeuteriophenyl)-8-phenyldibenzofuran-1-yl]-6-phenyl-1,3,5-triazine (PubChem CID 171050772) has the molecular formula C45H27N3O2 and a molecular weight of 646.76 g/mol. Its IUPAC name is 2-dibenzofuran-3-yl-4-[6-(2,3,4,5,6-pentadeuteriophenyl)-8-phenyldibenzofuran-1-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-3-yl-4-[6-(2,3,4,5,6-pentadeuteriophenyl)-8-phenyldibenzofuran-1-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171050772 |
| Molecular Formula | C45H27N3O2 |
| Molecular Weight | 646.76 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 2-dibenzofuran-3-yl-4-[6-(2,3,4,5,6-pentadeuteriophenyl)-8-phenyldibenzofuran-1-yl]-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3ccccc3)cc3c2oc2cccc(-c4nc(-c5ccccc5)nc(-c5ccc6c(c5)oc5ccccc56)n4)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C45H27N3O2/c1-4-13-28(14-5-1)32-25-36(29-15-6-2-7-16-29)42-37(26-32)41-35(20-12-22-39(41)50-42)45-47-43(30-17-8-3-9-18-30)46-44(48-45)31-23-24-34-33-19-10-11-21-38(33)49-40(34)27-31/h1-27H/i2D,6D,7D,15D,16D |
| InChIKey | LHZGPEBSNXLWBJ-RGKSOHIZSA-N |
| XLogP | 12.01 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.76 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |