C49H31N3O — CID 164808413
2-[6-(4-naphthalen-1-ylphenyl)dibenzofuran-1-yl]-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 164808413) has the molecular formula C49H31N3O and a molecular weight of 682.84 g/mol. Its IUPAC name is 2-[6-(4-naphthalen-1-ylphenyl)dibenzofuran-1-yl]-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[6-(4-naphthalen-1-ylphenyl)dibenzofuran-1-yl]-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 164808413 |
| Molecular Formula | C49H31N3O |
| Molecular Weight | 682.84 g/mol |
| Exact Mass | 682.28 |
| IUPAC Name | 2-[6-(4-naphthalen-1-ylphenyl)dibenzofuran-1-yl]-4-(2,3,4,5,6-pentadeuteriophenyl)-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-c3cccc4oc5c(-c6ccc(-c7cccc8ccccc78)cc6)cccc5c34)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C49H31N3O/c1-3-12-32(13-4-1)33-24-30-38(31-25-33)48-50-47(37-15-5-2-6-16-37)51-49(52-48)43-22-11-23-44-45(43)42-21-10-20-41(46(42)53-44)36-28-26-35(27-29-36)40-19-9-17-34-14-7-8-18-39(34)40/h1-31H/i2D,5D,6D,15D,16D |
| InChIKey | WVJHDEUHCXJWFP-KLZHWEBPSA-N |
| XLogP | 12.93 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.84 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |