C11H8O3 — CID 153284768
tricyclo[6.2.1.02,7]undeca-2(7),4-diene-3,6,11-trione (PubChem CID 153284768) has the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. Its IUPAC name is tricyclo[6.2.1.02,7]undeca-2(7),4-diene-3,6,11-trione.
| Compound Name | tricyclo[6.2.1.02,7]undeca-2(7),4-diene-3,6,11-trione |
|---|---|
| PubChem CID | 153284768 |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | tricyclo[6.2.1.02,7]undeca-2(7),4-diene-3,6,11-trione |
| SMILES | O=C1C=CC(=O)C2=C1C1CCC2C1=O |
| InChI | InChI=1S/C11H8O3/c12-7-3-4-8(13)10-6-2-1-5(9(7)10)11(6)14/h3-6H,1-2H2 |
| InChIKey | DJQKSFBGVLQHCB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|