C14H20O3 — CID 86112158
bicyclo[8.3.1]tetradecane-11,13,14-trione (PubChem CID 86112158) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is bicyclo[8.3.1]tetradecane-11,13,14-trione.
| Compound Name | bicyclo[8.3.1]tetradecane-11,13,14-trione |
|---|---|
| PubChem CID | 86112158 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | bicyclo[8.3.1]tetradecane-11,13,14-trione |
| SMILES | O=C1CC(=O)C2CCCCCCCCC1C2=O |
| InChI | InChI=1S/C14H20O3/c15-12-9-13(16)11-8-6-4-2-1-3-5-7-10(12)14(11)17/h10-11H,1-9H2 |
| InChIKey | RGYFOGZXQVLKTA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|