C12H20Cl2O — CID 98133852
trans-(2S,12S)-2,12-dichlorocyclododecan-1-one (PubChem CID 98133852) has the molecular formula C12H20Cl2O and a molecular weight of 251.20 g/mol. Its IUPAC name is trans-(2S,12S)-2,12-dichlorocyclododecan-1-one.
| Compound Name | trans-(2S,12S)-2,12-dichlorocyclododecan-1-one |
|---|---|
| PubChem CID | 98133852 |
| Molecular Formula | C12H20Cl2O |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | trans-(2S,12S)-2,12-dichlorocyclododecan-1-one |
| SMILES | O=C1[C@@H](Cl)CCCCCCCCC[C@@H]1Cl |
| InChI | InChI=1S/C12H20Cl2O/c13-10-8-6-4-2-1-3-5-7-9-11(14)12(10)15/h10-11H,1-9H2/t10-,11-/m0/s1 |
| InChIKey | MEHFXKFLCAZPSE-QWRGUYRKSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|