C6H7Cl3O — CID 131190784
(2R,3S,6S)-2,3,6-trichlorocyclohexan-1-one (PubChem CID 131190784) has the molecular formula C6H7Cl3O and a molecular weight of 201.48 g/mol. Its IUPAC name is (2R,3S,6S)-2,3,6-trichlorocyclohexan-1-one.
| Compound Name | (2R,3S,6S)-2,3,6-trichlorocyclohexan-1-one |
|---|---|
| PubChem CID | 131190784 |
| Molecular Formula | C6H7Cl3O |
| Molecular Weight | 201.48 g/mol |
| Exact Mass | 199.96 |
| IUPAC Name | (2R,3S,6S)-2,3,6-trichlorocyclohexan-1-one |
| SMILES | O=C1[C@@H](Cl)[C@@H](Cl)CC[C@@H]1Cl |
| InChI | InChI=1S/C6H7Cl3O/c7-3-1-2-4(8)6(10)5(3)9/h3-5H,1-2H2/t3-,4-,5-/m0/s1 |
| InChIKey | TWLVKYXIVDYAND-YUPRTTJUSA-N |
| XLogP | 2.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|