C10H15ClO — CID 134986855
(1R,8S,10R)-10-chlorobicyclo[6.2.0]decan-9-one (PubChem CID 134986855) has the molecular formula C10H15ClO and a molecular weight of 186.68 g/mol. Its IUPAC name is (1R,8S,10R)-10-chlorobicyclo[6.2.0]decan-9-one.
| Compound Name | (1R,8S,10R)-10-chlorobicyclo[6.2.0]decan-9-one |
|---|---|
| PubChem CID | 134986855 |
| Molecular Formula | C10H15ClO |
| Molecular Weight | 186.68 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (1R,8S,10R)-10-chlorobicyclo[6.2.0]decan-9-one |
| SMILES | O=C1[C@H]2CCCCCC[C@H]2[C@H]1Cl |
| InChI | InChI=1S/C10H15ClO/c11-9-7-5-3-1-2-4-6-8(7)10(9)12/h7-9H,1-6H2/t7-,8+,9-/m1/s1 |
| InChIKey | WQFMAARGHDDGIB-HRDYMLBCSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.68 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|