C7H7ClO2 — CID 98100771
(1R,4R)-7-chlorobicyclo[2.2.1]heptane-2,3-dione (PubChem CID 98100771) has the molecular formula C7H7ClO2 and a molecular weight of 158.58 g/mol. Its IUPAC name is (1R,4R)-7-chlorobicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | (1R,4R)-7-chlorobicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 98100771 |
| Molecular Formula | C7H7ClO2 |
| Molecular Weight | 158.58 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | (1R,4R)-7-chlorobicyclo[2.2.1]heptane-2,3-dione |
| SMILES | O=C1C(=O)[C@H]2CC[C@H]1C2Cl |
| InChI | InChI=1S/C7H7ClO2/c8-5-3-1-2-4(5)7(10)6(3)9/h3-5H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | HQZZGUDAHNYWJC-IMJSIDKUSA-N |
| XLogP | 0.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.58 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|