C7H8Cl2O — CID 10726026
(1S,5S)-6,7-dichlorobicyclo[3.2.0]heptan-2-one (PubChem CID 10726026) has the molecular formula C7H8Cl2O and a molecular weight of 179.05 g/mol. Its IUPAC name is (1S,5S)-6,7-dichlorobicyclo[3.2.0]heptan-2-one.
| Compound Name | (1S,5S)-6,7-dichlorobicyclo[3.2.0]heptan-2-one |
|---|---|
| PubChem CID | 10726026 |
| Molecular Formula | C7H8Cl2O |
| Molecular Weight | 179.05 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | (1S,5S)-6,7-dichlorobicyclo[3.2.0]heptan-2-one |
| SMILES | O=C1CC[C@@H]2C(Cl)C(Cl)[C@H]12 |
| InChI | InChI=1S/C7H8Cl2O/c8-6-3-1-2-4(10)5(3)7(6)9/h3,5-7H,1-2H2/t3-,5-,6?,7?/m0/s1 |
| InChIKey | NZGNBDMHDWBPFO-HXTBROQFSA-N |
| XLogP | 1.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.05 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|