C16H19NO5 — CID 11012185
(6R,6aS,11aR,11bR)-6a-methoxy-6-nitro-6,7,8,9,10,11,11a,11b-octahydrocyclohepta[a]naphthalene-1,4-dione (PubChem CID 11012185) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is (6R,6aS,11aR,11bR)-6a-methoxy-6-nitro-6,7,8,9,10,11,11a,11b-octahydrocyclohepta[a]naphthalene-1,4-dione.
| Compound Name | (6R,6aS,11aR,11bR)-6a-methoxy-6-nitro-6,7,8,9,10,11,11a,11b-octahydrocyclohepta[a]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 11012185 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (6R,6aS,11aR,11bR)-6a-methoxy-6-nitro-6,7,8,9,10,11,11a,11b-octahydrocyclohepta[a]naphthalene-1,4-dione |
| SMILES | CO[C@@]12CCCCC[C@@H]1[C@H]1C(=O)C=CC(=O)C1=C[C@H]2[N+](=O)[O-] |
| InChI | InChI=1S/C16H19NO5/c1-22-16-8-4-2-3-5-11(16)15-10(9-14(16)17(20)21)12(18)6-7-13(15)19/h6-7,9,11,14-15H,2-5,8H2,1H3/t11-,14-,15+,16+/m1/s1 |
| InChIKey | FTWJJVHIYHQFCF-FWYOQMDTSA-N |
| XLogP | 1.86 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|