C22H28N4O5 — CID 98363486
[(1S,4aR,8aR)-4a-hydroxy-1-(2-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone (PubChem CID 98363486) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is [(1S,4aR,8aR)-4a-hydroxy-1-(2-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone.
| Compound Name | [(1S,4aR,8aR)-4a-hydroxy-1-(2-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 98363486 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [(1S,4aR,8aR)-4a-hydroxy-1-(2-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(1-ethyl-4-nitropyrazol-3-yl)methanone |
| SMILES | CCn1cc([N+](=O)[O-])c(C(=O)N2CC[C@]3(O)CCCC[C@@H]3[C@H]2c2ccccc2OC)n1 |
| InChI | InChI=1S/C22H28N4O5/c1-3-24-14-17(26(29)30)19(23-24)21(27)25-13-12-22(28)11-7-6-9-16(22)20(25)15-8-4-5-10-18(15)31-2/h4-5,8,10,14,16,20,28H,3,6-7,9,11-13H2,1-2H3/t16-,20-,22-/m1/s1 |
| InChIKey | ARQCTSGZTDGSCV-BSLALVQMSA-N |
| XLogP | 3.33 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|