C30H41NO6 — CID 5133333
[1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(3,4,5-triethoxyphenyl)methanone (PubChem CID 5133333) has the molecular formula C30H41NO6 and a molecular weight of 511.66 g/mol. Its IUPAC name is [1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(3,4,5-triethoxyphenyl)methanone.
| Compound Name | [1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(3,4,5-triethoxyphenyl)methanone |
|---|---|
| PubChem CID | 5133333 |
| Molecular Formula | C30H41NO6 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | [1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-(3,4,5-triethoxyphenyl)methanone |
| SMILES | CCOc1ccccc1C1C2CCCCC2(O)CCN1C(=O)c1cc(OCC)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C30H41NO6/c1-5-34-24-15-10-9-13-22(24)27-23-14-11-12-16-30(23,33)17-18-31(27)29(32)21-19-25(35-6-2)28(37-8-4)26(20-21)36-7-3/h9-10,13,15,19-20,23,27,33H,5-8,11-12,14,16-18H2,1-4H3 |
| InChIKey | BIWBWLXLEJJNPK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |