C27H31NO5 — CID 6216706
(E)-3-(1,3-benzodioxol-5-yl)-1-[1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]prop-2-en-1-one (PubChem CID 6216706) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6216706 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]prop-2-en-1-one |
| SMILES | CCOc1ccccc1C1C2CCCCC2(O)CCN1C(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H31NO5/c1-2-31-22-9-4-3-7-20(22)26-21-8-5-6-14-27(21,30)15-16-28(26)25(29)13-11-19-10-12-23-24(17-19)33-18-32-23/h3-4,7,9-13,17,21,26,30H,2,5-6,8,14-16,18H2,1H3/b13-11+ |
| InChIKey | SEAWKEDAGUOXED-ACCUITESSA-N |
| XLogP | 4.72 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|