C19H27NO3 — CID 7088136
1-[(1S,4aS,8aR)-1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]ethanone (PubChem CID 7088136) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-[(1S,4aS,8aR)-1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]ethanone.
| Compound Name | 1-[(1S,4aS,8aR)-1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 7088136 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 1-[(1S,4aS,8aR)-1-(2-ethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]ethanone |
| SMILES | CCOc1ccccc1[C@@H]1[C@H]2CCCC[C@]2(O)CCN1C(C)=O |
| InChI | InChI=1S/C19H27NO3/c1-3-23-17-10-5-4-8-15(17)18-16-9-6-7-11-19(16,22)12-13-20(18)14(2)21/h4-5,8,10,16,18,22H,3,6-7,9,11-13H2,1-2H3/t16-,18-,19+/m1/s1 |
| InChIKey | CTGDXOZPIXKQGX-QRQLOZEOSA-N |
| XLogP | 3.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |