C25H30N2O4 — CID 4679828
N-[2-[4a-hydroxy-1-(2-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]benzamide (PubChem CID 4679828) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[2-[4a-hydroxy-1-(2-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[4a-hydroxy-1-(2-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 4679828 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[2-[4a-hydroxy-1-(2-methoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]benzamide |
| SMILES | COc1ccccc1C1C2CCCCC2(O)CCN1C(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H30N2O4/c1-31-21-13-6-5-11-19(21)23-20-12-7-8-14-25(20,30)15-16-27(23)22(28)17-26-24(29)18-9-3-2-4-10-18/h2-6,9-11,13,20,23,30H,7-8,12,14-17H2,1H3,(H,26,29) |
| InChIKey | FHVPZOAGUPZPDE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |