C7H7NO4 — CID 100936302
4-methoxy-2-nitrocyclohexa-2,5-dien-1-one (PubChem CID 100936302) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is 4-methoxy-2-nitrocyclohexa-2,5-dien-1-one.
| Compound Name | 4-methoxy-2-nitrocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 100936302 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 4-methoxy-2-nitrocyclohexa-2,5-dien-1-one |
| SMILES | COC1C=CC(=O)C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C7H7NO4/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-5H,1H3 |
| InChIKey | SAPQMAMNKRWJPR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|