C7H8N2O3 — CID 165416594
2-(aminomethyl)-4-nitrocyclohexa-2,5-dien-1-one (PubChem CID 165416594) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 2-(aminomethyl)-4-nitrocyclohexa-2,5-dien-1-one.
| Compound Name | 2-(aminomethyl)-4-nitrocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 165416594 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2-(aminomethyl)-4-nitrocyclohexa-2,5-dien-1-one |
| SMILES | NCC1=CC([N+](=O)[O-])C=CC1=O |
| InChI | InChI=1S/C7H8N2O3/c8-4-5-3-6(9(11)12)1-2-7(5)10/h1-3,6H,4,8H2 |
| InChIKey | RIRRHVGTJTXLLP-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|