C7H7N3O3 — CID 124848141
(3aR,7aR)-6-nitro-1,2,3a,7a-tetrahydroindazol-3-one (PubChem CID 124848141) has the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. Its IUPAC name is (3aR,7aR)-6-nitro-1,2,3a,7a-tetrahydroindazol-3-one.
| Compound Name | (3aR,7aR)-6-nitro-1,2,3a,7a-tetrahydroindazol-3-one |
|---|---|
| PubChem CID | 124848141 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | (3aR,7aR)-6-nitro-1,2,3a,7a-tetrahydroindazol-3-one |
| SMILES | O=C1NN[C@@H]2C=C([N+](=O)[O-])C=C[C@@H]12 |
| InChI | InChI=1S/C7H7N3O3/c11-7-5-2-1-4(10(12)13)3-6(5)8-9-7/h1-3,5-6,8H,(H,9,11)/t5-,6-/m1/s1 |
| InChIKey | MGKCSCRXZRIECA-PHDIDXHHSA-N |
| XLogP | -0.66 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|