C12H8F2N2O4 — CID 135337941
1-(4,6-difluorocyclohexa-2,4-dien-1-yl)-3,5-dinitrobenzene (PubChem CID 135337941) has the molecular formula C12H8F2N2O4 and a molecular weight of 282.20 g/mol. Its IUPAC name is 1-(4,6-difluorocyclohexa-2,4-dien-1-yl)-3,5-dinitrobenzene.
| Compound Name | 1-(4,6-difluorocyclohexa-2,4-dien-1-yl)-3,5-dinitrobenzene |
|---|---|
| PubChem CID | 135337941 |
| Molecular Formula | C12H8F2N2O4 |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1-(4,6-difluorocyclohexa-2,4-dien-1-yl)-3,5-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cc(C2C=CC(F)=CC2F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H8F2N2O4/c13-8-1-2-11(12(14)5-8)7-3-9(15(17)18)6-10(4-7)16(19)20/h1-6,11-12H |
| InChIKey | VSDRYPNGMSSUEV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|