C9H11N5O5 — CID 174545739
4-amino-2-[(6Z)-6-hydroxyimino-4-nitrocyclohexa-2,4-dien-1-yl]-3-oxido-2,5-dihydro-1H-imidazol-3-ium-5-ol (PubChem CID 174545739) has the molecular formula C9H11N5O5 and a molecular weight of 269.22 g/mol. Its IUPAC name is 4-amino-2-[(6Z)-6-hydroxyimino-4-nitrocyclohexa-2,4-dien-1-yl]-3-oxido-2,5-dihydro-1H-imidazol-3-ium-5-ol.
| Compound Name | 4-amino-2-[(6Z)-6-hydroxyimino-4-nitrocyclohexa-2,4-dien-1-yl]-3-oxido-2,5-dihydro-1H-imidazol-3-ium-5-ol |
|---|---|
| PubChem CID | 174545739 |
| Molecular Formula | C9H11N5O5 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-amino-2-[(6Z)-6-hydroxyimino-4-nitrocyclohexa-2,4-dien-1-yl]-3-oxido-2,5-dihydro-1H-imidazol-3-ium-5-ol |
| SMILES | NC1=[N+]([O-])C(C2C=CC([N+](=O)[O-])=C/C2=N/O)NC1O |
| InChI | InChI=1S/C9H11N5O5/c10-7-9(15)11-8(13(7)17)5-2-1-4(14(18)19)3-6(5)12-16/h1-3,5,8-9,11,15-16H,10H2/b12-6- |
| InChIKey | PXFRBTDFXUGOPU-SDQBBNPISA-N |
| XLogP | -1.72 |
| TPSA | 160.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|