C15H19N3O2 — CID 142853173
9-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-3-nitro-7-azabicyclo[4.3.1]deca-2,4,8-triene (PubChem CID 142853173) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 9-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-3-nitro-7-azabicyclo[4.3.1]deca-2,4,8-triene.
| Compound Name | 9-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-3-nitro-7-azabicyclo[4.3.1]deca-2,4,8-triene |
|---|---|
| PubChem CID | 142853173 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 9-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-3-nitro-7-azabicyclo[4.3.1]deca-2,4,8-triene |
| SMILES | CN1CC=C(C2=CNC3C=CC([N+](=O)[O-])=CC2C3)CC1 |
| InChI | InChI=1S/C15H19N3O2/c1-17-6-4-11(5-7-17)15-10-16-13-2-3-14(18(19)20)9-12(15)8-13/h2-4,9-10,12-13,16H,5-8H2,1H3 |
| InChIKey | XTWGWSKCNDBTAB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|