About 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile
2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile (PubChem CID 170324676) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile |
| PubChem CID | 170324676 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile |
| SMILES | CN1CC=C(c2ccc([N+](=O)[O-])cc2CC#N)CC1 |
| InChI | InChI=1S/C14H15N3O2/c1-16-8-5-11(6-9-16)14-3-2-13(17(18)19)10-12(14)4-7-15/h2-3,5,10H,4,6,8-9H2,1H3 |
| InChIKey | XDKRVXJUWMMJOT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile?
The IUPAC name of 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile (CID 170324676) is 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile.
What is the SMILES notation for 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile?
The canonical SMILES for 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile is CN1CC=C(c2ccc([N+](=O)[O-])cc2CC#N)CC1.
What is the InChIKey of 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile?
The InChIKey is XDKRVXJUWMMJOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c1-16-8-5-11(6-9-16)14-3-2-13(17(18)19)10-12(14)4-7-15/h2-3,5,10H,4,6,8-9H2,1H3.
What are the key properties of 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile?
2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile has a molecular weight of 257.29 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-nitrophenyl]acetonitrile is sourced from PubChem (CID 170324676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).