C13H13NO3 — CID 173278090
6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene (PubChem CID 173278090) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene.
| Compound Name | 6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 173278090 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 6-methoxy-1-nitro-3-phenylcyclohexa-1,4-diene |
| SMILES | COC1C=CC(c2ccccc2)C=C1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13NO3/c1-17-13-8-7-11(9-12(13)14(15)16)10-5-3-2-4-6-10/h2-9,11,13H,1H3 |
| InChIKey | ILQPBPFRFZGISD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|