C11H11N3O5 — CID 62881212
3-(2-methoxy-4-nitroanilino)pyrrolidine-2,5-dione (PubChem CID 62881212) has the molecular formula C11H11N3O5 and a molecular weight of 265.23 g/mol. Its IUPAC name is 3-(2-methoxy-4-nitroanilino)pyrrolidine-2,5-dione.
| Compound Name | 3-(2-methoxy-4-nitroanilino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 62881212 |
| Molecular Formula | C11H11N3O5 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-(2-methoxy-4-nitroanilino)pyrrolidine-2,5-dione |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC1CC(=O)NC1=O |
| InChI | InChI=1S/C11H11N3O5/c1-19-9-4-6(14(17)18)2-3-7(9)12-8-5-10(15)13-11(8)16/h2-4,8,12H,5H2,1H3,(H,13,15,16) |
| InChIKey | RGCMAAVKVJOYNN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|