C11H9ClN2O5 — CID 106694928
3-chloro-4-(2-methoxy-4-nitrophenyl)pyrrolidine-2,5-dione (PubChem CID 106694928) has the molecular formula C11H9ClN2O5 and a molecular weight of 284.66 g/mol. Its IUPAC name is 3-chloro-4-(2-methoxy-4-nitrophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-chloro-4-(2-methoxy-4-nitrophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 106694928 |
| Molecular Formula | C11H9ClN2O5 |
| Molecular Weight | 284.66 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 3-chloro-4-(2-methoxy-4-nitrophenyl)pyrrolidine-2,5-dione |
| SMILES | COc1cc([N+](=O)[O-])ccc1C1C(=O)NC(=O)C1Cl |
| InChI | InChI=1S/C11H9ClN2O5/c1-19-7-4-5(14(17)18)2-3-6(7)8-9(12)11(16)13-10(8)15/h2-4,8-9H,1H3,(H,13,15,16) |
| InChIKey | FFJAYEZOMMJTHL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.66 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|