C19H27N3O3 — CID 178017408
3-[4-(3,3-dimethylpiperidin-4-yl)-2-methoxyanilino]piperidine-2,6-dione (PubChem CID 178017408) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-[4-(3,3-dimethylpiperidin-4-yl)-2-methoxyanilino]piperidine-2,6-dione.
| Compound Name | 3-[4-(3,3-dimethylpiperidin-4-yl)-2-methoxyanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178017408 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-[4-(3,3-dimethylpiperidin-4-yl)-2-methoxyanilino]piperidine-2,6-dione |
| SMILES | COc1cc(C2CCNCC2(C)C)ccc1NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C19H27N3O3/c1-19(2)11-20-9-8-13(19)12-4-5-14(16(10-12)25-3)21-15-6-7-17(23)22-18(15)24/h4-5,10,13,15,20-21H,6-9,11H2,1-3H3,(H,22,23,24) |
| InChIKey | IZGJVZHGPRYNCQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|