C15H21ClN2O3 — CID 170953480
3-(5-chloro-2-methoxy-4-methylanilino)piperidine-2,6-dione;ethane (PubChem CID 170953480) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxy-4-methylanilino)piperidine-2,6-dione;ethane.
| Compound Name | 3-(5-chloro-2-methoxy-4-methylanilino)piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 170953480 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-(5-chloro-2-methoxy-4-methylanilino)piperidine-2,6-dione;ethane |
| SMILES | CC.COc1cc(C)c(Cl)cc1NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H15ClN2O3.C2H6/c1-7-5-11(19-2)10(6-8(7)14)15-9-3-4-12(17)16-13(9)18;1-2/h5-6,9,15H,3-4H2,1-2H3,(H,16,17,18);1-2H3 |
| InChIKey | DOYYQLZOFAFANY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|