C18H30N2O3 — CID 11809451
(2S)-1-[(4aS,5S,8R,8aS)-5,8-dimethyl-7-nitro-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-yl]-2-(methoxymethyl)pyrrolidine (PubChem CID 11809451) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is (2S)-1-[(4aS,5S,8R,8aS)-5,8-dimethyl-7-nitro-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-yl]-2-(methoxymethyl)pyrrolidine.
| Compound Name | (2S)-1-[(4aS,5S,8R,8aS)-5,8-dimethyl-7-nitro-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-yl]-2-(methoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 11809451 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (2S)-1-[(4aS,5S,8R,8aS)-5,8-dimethyl-7-nitro-2,3,4,5,8,8a-hexahydro-1H-naphthalen-4a-yl]-2-(methoxymethyl)pyrrolidine |
| SMILES | COC[C@@H]1CCCN1[C@]12CCCC[C@H]1[C@@H](C)C([N+](=O)[O-])=C[C@@H]2C |
| InChI | InChI=1S/C18H30N2O3/c1-13-11-17(20(21)22)14(2)16-8-4-5-9-18(13,16)19-10-6-7-15(19)12-23-3/h11,13-16H,4-10,12H2,1-3H3/t13-,14+,15-,16-,18-/m0/s1 |
| InChIKey | ZSLQXTWAVPFRRG-IWSXDTNSSA-N |
| XLogP | 3.47 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|