C13H21NO4 — CID 10777399
(3R,4S,4aR,8aS)-4-(methoxymethyl)-3-methyl-4a-nitro-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 10777399) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is (3R,4S,4aR,8aS)-4-(methoxymethyl)-3-methyl-4a-nitro-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (3R,4S,4aR,8aS)-4-(methoxymethyl)-3-methyl-4a-nitro-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 10777399 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (3R,4S,4aR,8aS)-4-(methoxymethyl)-3-methyl-4a-nitro-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | COC[C@H]1[C@@H](C)C(=O)C[C@@H]2CCCC[C@@]21[N+](=O)[O-] |
| InChI | InChI=1S/C13H21NO4/c1-9-11(8-18-2)13(14(16)17)6-4-3-5-10(13)7-12(9)15/h9-11H,3-8H2,1-2H3/t9-,10+,11+,13-/m1/s1 |
| InChIKey | WQBMGNMFBQQNNV-MPPDQPJWSA-N |
| XLogP | 2.06 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|