C12H17NO4 — CID 15358789
1-nitrobicyclo[6.3.1]dodecane-9,12-dione (PubChem CID 15358789) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-nitrobicyclo[6.3.1]dodecane-9,12-dione.
| Compound Name | 1-nitrobicyclo[6.3.1]dodecane-9,12-dione |
|---|---|
| PubChem CID | 15358789 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-nitrobicyclo[6.3.1]dodecane-9,12-dione |
| SMILES | O=C1CCC2([N+](=O)[O-])CCCCCCC1C2=O |
| InChI | InChI=1S/C12H17NO4/c14-10-6-8-12(13(16)17)7-4-2-1-3-5-9(10)11(12)15/h9H,1-8H2 |
| InChIKey | OLRAWTYFBPNDKR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|