C12H19NO4 — CID 10514253
(3S,4aS,8aS)-3-ethoxy-4a-nitro-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 10514253) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (3S,4aS,8aS)-3-ethoxy-4a-nitro-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (3S,4aS,8aS)-3-ethoxy-4a-nitro-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 10514253 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (3S,4aS,8aS)-3-ethoxy-4a-nitro-1,3,4,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | CCO[C@H]1C[C@@]2([N+](=O)[O-])CCCC[C@H]2CC1=O |
| InChI | InChI=1S/C12H19NO4/c1-2-17-11-8-12(13(15)16)6-4-3-5-9(12)7-10(11)14/h9,11H,2-8H2,1H3/t9-,11-,12-/m0/s1 |
| InChIKey | ZAMCWOJBAYJZRN-DLOVCJGASA-N |
| XLogP | 1.96 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|