C9H16N2O5 — CID 129438132
(1R,2S,3R)-3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane (PubChem CID 129438132) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is (1R,2S,3R)-3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane.
| Compound Name | (1R,2S,3R)-3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane |
|---|---|
| PubChem CID | 129438132 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (1R,2S,3R)-3-ethoxy-1,2-dimethyl-1,2-dinitrocyclopentane |
| SMILES | CCO[C@@H]1CC[C@@](C)([N+](=O)[O-])[C@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N2O5/c1-4-16-7-5-6-8(2,10(12)13)9(7,3)11(14)15/h7H,4-6H2,1-3H3/t7-,8-,9-/m1/s1 |
| InChIKey | DOCFGWBVCNNGMY-IWSPIJDZSA-N |
| XLogP | 1.26 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|