C8H14N2O5 — CID 15741537
(1S,2R,3R)-3-methoxy-1,2-dimethyl-1,2-dinitrocyclopentane (PubChem CID 15741537) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is (1S,2R,3R)-3-methoxy-1,2-dimethyl-1,2-dinitrocyclopentane.
| Compound Name | (1S,2R,3R)-3-methoxy-1,2-dimethyl-1,2-dinitrocyclopentane |
|---|---|
| PubChem CID | 15741537 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1S,2R,3R)-3-methoxy-1,2-dimethyl-1,2-dinitrocyclopentane |
| SMILES | CO[C@@H]1CC[C@](C)([N+](=O)[O-])[C@@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N2O5/c1-7(9(11)12)5-4-6(15-3)8(7,2)10(13)14/h6H,4-5H2,1-3H3/t6-,7+,8+/m1/s1 |
| InChIKey | GHFPJXWGNJOSSH-CSMHCCOUSA-N |
| XLogP | 0.87 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|